|
| (S)-3-(Allylsulphinyl)-L-alanine Basic information |
| (S)-3-(Allylsulphinyl)-L-alanine Chemical Properties |
Melting point | 164-166° (effervescence) | alpha | D20 +63.5° (c = 2) | Boiling point | 416.1±45.0 °C(Predicted) | density | 1.205 (estimate) | refractive index | 1.5500 (estimate) | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | pka | 1.88±0.10(Predicted) | form | solid | Merck | 13,259 | InChI | InChI=1/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11-/s3 | InChIKey | XUHLIQGRKRUKPH-DYEAUMGKSA-N | SMILES | C(O)(=O)[C@H](C[S@](CC=C)=O)N |&1:3,5,r| | LogP | -0.478 (est) | CAS DataBase Reference | 556-27-4(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26 | WGK Germany | 3 | F | 8-10 | HS Code | 29309090 |
| (S)-3-(Allylsulphinyl)-L-alanine Usage And Synthesis |
Uses | antibacterial, antioxidant | Definition | ChEBI: An L-alanine derivative in which one of the methyl hydrogens of L-alanine has been replaced by an (S)-allylsulfinyl group. | target | PPAR | TNF-α | IL Receptor | NF-kB | SOD | NADPH-oxidase | ROS |
| (S)-3-(Allylsulphinyl)-L-alanine Preparation Products And Raw materials |
|