|
| Cyclohexanecarboxylic acid, 4-hydroxy-, Methyl ester, cis- Basic information |
| Cyclohexanecarboxylic acid, 4-hydroxy-, Methyl ester, cis- Chemical Properties |
Boiling point | 233.3±33.0℃ (760 Torr) | density | 1.121±0.06 g/cm3 (20 ºC 760 Torr) | refractive index | 1.4705 (589.3 nm 21.5℃) | Fp | 93.5±18.2℃ | storage temp. | Sealed in dry,Store in freezer, under -20°C | pka | 14.96±0.40(Predicted) | InChI | InChI=1S/C8H14O3/c1-11-8(10)6-2-4-7(9)5-3-6/h6-7,9H,2-5H2,1H3/t6-,7+ | InChIKey | HYDYVXROZHFTGB-KNVOCYPGSA-N | SMILES | [C@@H]1(C(OC)=O)CC[C@H](O)CC1 |
| Cyclohexanecarboxylic acid, 4-hydroxy-, Methyl ester, cis- Usage And Synthesis |
Uses | Methyl 4-hydroxycyclohexylcarboxylate is a carboxylate derivative and can be used as an organic intermediate. |
| Cyclohexanecarboxylic acid, 4-hydroxy-, Methyl ester, cis- Preparation Products And Raw materials |
|