|
| | COLURACETAM Basic information |
| Product Name: | COLURACETAM | | Synonyms: | COLURACETAM;N-(2,3-Dimethyl-5,6,7,8-tetrahydrofuro[2,3-b]quinolin-4-yl)-2-(2-oxopyrrolidin-1-yl)acetamide;1-Pyrrolidineacetamide,2-oxo-N-(5,6,7,8-tetrahydro-2,3-dimethylfuro[2,3-b]quinolin-4-yl)-;Coluracetam, MKC-231;1-[N-(2,3-DiMethyl-5,6,7,8-tetrahydrofuro[2,3-b]quinolin-4-yl)carbaMoylMethyl]pyrrolidin-2-one;BCI-540;Coluracetam, >=99%;2-oxo-N-(5,6,7,8-tetrahydro-2,3-dimethyl-furo[2,3-b]quinolin-4-yl)-1-pyrrolidineacetamide | | CAS: | 135463-81-9 | | MF: | C19H23N3O3 | | MW: | 341.4 | | EINECS: | 1308068-626-2 | | Product Categories: | Brain health drug;Nootropic;pharmaceutical intermediate or medicine grade;pharmaceutical | | Mol File: | 135463-81-9.mol |  |
| | COLURACETAM Chemical Properties |
| Boiling point | 634.1±55.0 °C(Predicted) | | density | 1.291±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMF: 1 mg/ml; DMSO: 2 mg/ml; Ethanol: 2 mg/ml; PBS (pH 7.2): insol | | pka | 12.01±0.20(Predicted) | | form | A crystalline solid | | InChI | InChI=1S/C19H23N3O3/c1-11-12(2)25-19-17(11)18(13-6-3-4-7-14(13)20-19)21-15(23)10-22-9-5-8-16(22)24/h3-10H2,1-2H3,(H,20,21,23) | | InChIKey | PSPGQHXMUKWNDI-UHFFFAOYSA-N | | SMILES | N1(CC(NC2C3=C(N=C4OC(C)=C(C)C4=2)CCCC3)=O)CCCC1=O |
| | COLURACETAM Usage And Synthesis |
| Uses | Copiracetam can be used as a nootropic drug to treat memory and intellectual impairments caused by senile dementia, mild to moderate vascular dementia, trauma and other diseases, and to promote children's intellectual development; it also has antidepressant effects. | | Pharmacology | Copiracetam has the ability to improve cognition by participating in the HACU process, increasing the rate-limiting step of synaptic intake of choline to synthesize the neurotransmitter acetylcholine, and increasing the activity of cholinergic neurons. |
| | COLURACETAM Preparation Products And Raw materials |
|
