|
| | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | Isopropoxyboronic acid pinacol;Isopropoxyboronic acid picol ester;2-ISOPROPOXY-4,4,5,5-TETRAMETHYL-1,3,2-DIOABOROLANE;2-Isopropoxyboronic acid, pinacol cyclic ester;Isopropoxyboronic acid pinacol ester
2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-Isopropoxy-4,4,5,5-dimethyl-1,3,2-dioxaborolane;AKOS BRN-0268;2-ISOPROPOXY-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE | | CAS: | 61676-62-8 | | MF: | C9H19BO3 | | MW: | 186.06 | | EINECS: | 612-189-2 | | Product Categories: | Boric Acid| Boric Acid Ester| Potassium Trifluoroborate;B (Classes of Boron Compounds);Boric Acid Esters;Boric Acid Triesters;Boronic Acids and Derivatives;Organoborates;Organometallic Reagents;Organic boronic acid;Boronic ester;Organoborons | | Mol File: | 61676-62-8.mol |  |
| | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 73 °C15 mm Hg(lit.) | | density | 0.912 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.409(lit.) | | Fp | 109 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | Specific Gravity | 0.912 | | color | Colorless | | Water Solubility | Soluble in water. | | Sensitive | Moisture Sensitive | | BRN | 1906370 | | InChI | InChI=1S/C9H19BO3/c1-7(2)11-10-12-8(3,4)9(5,6)13-10/h7H,1-6H3 | | InChIKey | MRWWWZLJWNIEEJ-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1OC(C)C | | CAS DataBase Reference | 61676-62-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29209090 |
| | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane can be used as a reagent to borylate arenes and to prepare fluorenylborolane.
It can also be used in the synthesis of following intermediates for generating conjugated copolymers:
- 9,9-Dioctyl-2,7-bis(4,4,5,5-tetramethyl1,3,2-dioxaborolane-2-yl)dibenzosilole.
- 3,9-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-di(1-decylundecyl)indolo[3,2-b]carbazole.
- 2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9-dioctylfluorene.
- 2,7-Bis(4′,4′,5′,5′-tetramethyl-1′,3′,2′-dioxaborolan-2′-yl)-N-9′′-heptadecanylcarbazole.
| | Uses | suzuki reaction |
| | 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|
