|
| | piperine Basic information |
| Product Name: | piperine | | Synonyms: | 1-[5-(1,3-Benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]piperidine;1-Piperidino-5-(1,3-benzodioxole-5-yl)-2,4-pentadiene-1-one;Piperine;Piperidine, 1-[5-(3,4-methylenedioxyphenyl)-1-oxo-2,4-pentadienyl]-;2,4-Pentadien-1-one, 5-(1,3-benzodioxol-5-yl)-1-(1-piperidinyl)-;5-stilbenediol;SichuanPepper oil | | CAS: | 7780-20-3 | | MF: | C17H19NO3 | | MW: | 285.34 | | EINECS: | 202-348-0 | | Product Categories: | | | Mol File: | 7780-20-3.mol |  |
| | piperine Chemical Properties |
| Melting point | 129 °C | | Boiling point | 498.5±40.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | pka | -0.71±0.20(Predicted) | | InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2 | | InChIKey | MXXWOMGUGJBKIW-UHFFFAOYSA-N | | SMILES | C(N1CCCCC1)(=O)C=CC=CC1=CC=C2OCOC2=C1 | | LogP | 3.365 (est) |
| | piperine Usage And Synthesis |
| Definition | ChEBI: Piperine is a N-acylpiperidine that is piperidine substituted by a (1E,3E)-1-(1,3-benzodioxol-5-yl)-5-oxopenta-1,3-dien-5-yl group at the nitrogen atom. It is an alkaloid isolated from the plant Piper nigrum. It has a role as a NF-kappaB inhibitor, a plant metabolite, a food component and a human blood serum metabolite. It is a member of benzodioxoles, a N-acylpiperidine, a piperidine alkaloid and a tertiary carboxamide. It is functionally related to an (E,E)-piperic acid. |
| | piperine Preparation Products And Raw materials |
|
