|
| 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone Basic information |
| 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone Chemical Properties |
Melting point | 185-189°C | Boiling point | 467.8±55.0 °C(Predicted) | density | 1.26±0.1 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | solubility | DMSO: ≥10mg/mL | pka | 1.35±0.20(Predicted) | form | powder | color | off-white to light tan | InChI | InChI=1S/C14H18N2O5/c1-18-3-5-20-12-7-10-11(15-9-16-14(10)17)8-13(12)21-6-4-19-2/h7-9H,3-6H2,1-2H3,(H,15,16,17) | InChIKey | PMQWTUWLIGJTQD-UHFFFAOYSA-N | SMILES | N1C2=C(C=C(OCCOC)C(OCCOC)=C2)C(=O)NC=1 | CAS DataBase Reference | 179688-29-0(CAS DataBase Reference) |
WGK Germany | 3 | HS Code | 2933.59.8000 |
| 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone Usage And Synthesis |
Chemical Properties | Off-White Solid | Uses | An intermediate in the synthesis of Erlotinib (E625000). |
| 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone Preparation Products And Raw materials |
|