|
| | 1,3-Bis(4-aMinophenoxy)benzene Basic information |
| Product Name: | 1,3-Bis(4-aMinophenoxy)benzene | | Synonyms: | 4,4-(1,3-PHENEDIOXY)DIANILINE;Benzenamine, 4,4'-[1,3-phenylenebis(oxy)]bis-;4,4'-[1,3-phenylenebis(oxy)]dianiline;4,4'-(m-Phenylenebisoxy)bis(aniline);4,4'-(m-Phenylenebisoxy)dianiline;4,4'-(m-Phenylenedioxy)bisaniline;RESORCINOL BIS(4-AMINOPHENYL) ETHER;1,3-BIS(4-AMINOPHENOXY)BENZENE | | CAS: | 2479-46-1 | | MF: | C18H16N2O2 | | MW: | 292.33 | | EINECS: | 628-902-5 | | Product Categories: | Amine Monomers;Monomers;Primary Amines;Electronic Chemicals;Miscellaneous;Diphenyl Ethers (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;2479-46-1 | | Mol File: | 2479-46-1.mol |  |
| | 1,3-Bis(4-aMinophenoxy)benzene Chemical Properties |
| Melting point | 115-118 °C(lit.) | | Boiling point | 434.27°C (rough estimate) | | density | 1.1925 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | very faint turbidity in Acetonitrile | | pka | 5.06±0.10(Predicted) | | form | powder to crystal | | color | White to Brown | | InChI | InChI=1S/C18H16N2O2/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16/h1-12H,19-20H2 | | InChIKey | WUPRYUDHUFLKFL-UHFFFAOYSA-N | | SMILES | C1(OC2=CC=C(N)C=C2)=CC=CC(OC2=CC=C(N)C=C2)=C1 | | CAS DataBase Reference | 2479-46-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 4,4'-[1,3-phenylenebis(oxy)]bis- (2479-46-1) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | BY8236000 | | HS Code | 29222990 |
| | 1,3-Bis(4-aMinophenoxy)benzene Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses | 1,3-Bis(4'-aminophenoxyl)benzene be used for the preparation of a polyimide material. |
| | 1,3-Bis(4-aMinophenoxy)benzene Preparation Products And Raw materials |
|
