|
| | β-Methylcholine Chloride Basic information |
| Product Name: | β-Methylcholine Chloride | | Synonyms: | 1-Propanaminium,2-hydroxy-N,N,N-trimethyl-, chloride (1:1);2-hydroxypropyl(trimethyl)azanium,chloride;(2-hydroxypropyl)trimethyl-ammoniuchloride;2-hydroxy-n,n,n-trimethyl-1-propanaminiuchloride;2-hydroxy-n,n,n-trimethyl-1-propanaminiumchloride;BETA-METHYLCHOLINE CHLORIDE;2-HYDROXYPROPYLTRIMETHYLAMMONIUM CHLORIDE;7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydrox-4-oxo-quinoline-3-carboxylicacidmethylester | | CAS: | 2382-43-6 | | MF: | C6H16ClNO | | MW: | 153.65 | | EINECS: | 219-183-5 | | Product Categories: | Ammonium Chlorides (Quaternary);Quaternary Ammonium Compounds | | Mol File: | 2382-43-6.mol |  |
| | β-Methylcholine Chloride Chemical Properties |
| Melting point | 165°C | | density | 1.0183 (rough estimate) | | refractive index | 1.5618 (estimate) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | almost transparency | | InChI | InChI=1S/C6H16NO.ClH/c1-6(8)5-7(2,3)4;/h6,8H,5H2,1-4H3;1H/q+1;/p-1 | | InChIKey | RUUHDEGJEGHQKL-UHFFFAOYSA-M | | SMILES | [N+](C)(C)(C)CC(O)C.[Cl-] | | EPA Substance Registry System | 1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-, chloride (2382-43-6) |
| Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | RTECS | BR5220000 | | HS Code | 2923.90.0100 | | Toxicity | mouse,LDLo,subcutaneous,630mg/kg (630mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 1, Pg. 303, 1909. |
| | β-Methylcholine Chloride Usage And Synthesis |
| Chemical Properties | White to Light yellow to Light orange powder to crystal. | | Uses | β-Methylcholine Chloride is a chitosan quaternized derivative that is used to prepare and study its applicability in anion exchange membrane fuel cells. | | Application | β-Methylcholine Chloride is a biochemical reagent that can be used as a
biological material or organic compound for life science related
research. |
| | β-Methylcholine Chloride Preparation Products And Raw materials |
|
