|
| | [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) Basic information |
| Product Name: | [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) | | Synonyms: | Chemical Name：1,2-Bis(diphenylphosphino)ethane palladium(II) chloride,98%;Dichloro(1,2-bis(diphenylphosphino)ethane)palladiuM(II),98% (DPPE)PdCl2;[1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)
Dichloro[1,2-bis(diphenylphosphino)ethane]palladium(II);1,2-Bis(diphenylphosphino)ethane palladium (II) dichloride, 98+%;[1,2-Bis(diphenylphosphiNA)ethane]dichloropalladiuM(II);Dichloro(1,2-bis(diphenylphosphino)ethane)palladiuM(II),(DPPE)PdCl2;[1,2-Bis(diphenylphosphino)ethane]dichloropalladiuM(Ⅱ), 19% Pd, Product of UMicore;Dichloro[1,2-bis(diphenylphosphino)ethane]palladiuM(II), Pd 18.5% | | CAS: | 19978-61-1 | | MF: | C26H24Cl2P2Pd | | MW: | 575.74 | | EINECS: | 625-508-5 | | Product Categories: | chemical reaction,pharm,electronic,materials;metal-phosphine complexes;Metal Compounds;API intermediates;Catalysts-Ligands;Pd;Catalysts for Organic Synthesis;Classes of Metal Compounds;Homogeneous Catalysts;Metal Complexes;Pd (Palladium) Compounds;Synthetic Organic Chemistry;Transition Metal Compounds;Catalysis and Inorganic Chemistry;Homogeneous Pd Catalysts;Palladium | | Mol File: | 19978-61-1.mol | ![[1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) Structure](CAS/GIF/19978-61-1.gif) |
| | [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) Chemical Properties |
| Melting point | 360 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | off-white | | Water Solubility | insoluble | | Sensitive | Moisture sensitive | | InChI | InChI=1S/C26H24P2.2ClH.Pd/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2/p-2 | | InChIKey | LDJXFZUGZASGIW-UHFFFAOYSA-L | | SMILES | C(P(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1.[Pd](Cl)Cl | | CAS DataBase Reference | 19978-61-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 28439000 |
| | [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) Usage And Synthesis |
| Chemical Properties | orange powder | | Uses | [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) is a precatalyst used in the production of acrylic acid sodium salt via coupling of CO2 with ethene.
suzuki reaction. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
core: palladium | | Precautions | This palladium catalyst, also known as [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II), presents as a very pale yellow to yellow crystalline powder. Store under inert gas, at ambient temperatures and protected from moisture. This substance is moisture sensitive. [1,2-Bis(diphenylphosphino)ethane]palladium(II) Dichloride is incompatible with oxidizing agents. This chemical is harmful if swallowed, in contact with skin or if inhaled. It causes skin irritation as well as serious eye irritation. |
| | [1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II) Preparation Products And Raw materials |
|
