|
| Norandrostenedione Basic information |
| Norandrostenedione Chemical Properties |
Melting point | 169-172°C | alpha | +134~+143°(D/25℃)(c=0.5,C2H5OH) | Boiling point | 433.4±45.0 °C(Predicted) | density | 1.13±0.1 g/cm3(Predicted) | vapor pressure | 0.001Pa at 25℃ | storage temp. | Refrigerator | solubility | DMF: 25 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml | form | A crystalline solid | Water Solubility | 191mg/L at 20℃ | InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-16H,2-9H2,1H3/t13-,14+,15+,16-,18-/m0/s1 | InChIKey | JRIZOGLBRPZBLQ-QXUSFIETSA-N | SMILES | C1(=O)C=C2[C@]([H])(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(=O)CC3)CC2 | LogP | 2.18 at 25℃ | CAS DataBase Reference | 734-32-7(CAS DataBase Reference) |
| Norandrostenedione Usage And Synthesis |
Chemical Properties | Off-White Solid | Uses | Norethindrone intermediate | Definition | ChEBI: 19-Norandrostenedione is a 3-oxo steroid. | Flammability and Explosibility | Notclassified |
| Norandrostenedione Preparation Products And Raw materials |
|