|
| | 1,4-Bis(dimethylsilyl)benzene Basic information |
| Product Name: | 1,4-Bis(dimethylsilyl)benzene | | Synonyms: | 1,4-phenylenebis(dimethyl-silan;p-Bis(dimethysilyl)benzene;p-phenylenebis(dimethyl-silan;Silane, 1,4-phenylenebis[dimethyl-;Silane, p-phenylenebis(dimethyl-;1,4-BIS(DIMETHYLSILYL)BENZENE;1,4 BIS(DIMETHYLSILYL)BENZENE MIN;1,4-phenylenebis[dimethylsilane] | | CAS: | 2488-01-9 | | MF: | C10H18Si2 | | MW: | 194.42 | | EINECS: | 219-638-8 | | Product Categories: | | | Mol File: | 2488-01-9.mol |  |
| | 1,4-Bis(dimethylsilyl)benzene Chemical Properties |
| Melting point | 115 °C | | Boiling point | 213-214 °C(lit.) | | density | 0.874 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.502(lit.) | | Fp | 185 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.872 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | BRN | 1072658 | | InChI | InChI=1S/C10H18Si2/c1-11(2)9-5-7-10(8-6-9)12(3)4/h5-8,11-12H,1-4H3 | | InChIKey | KQERVIARWMHFOS-UHFFFAOYSA-N | | SMILES | C1([SiH](C)C)=CC=C([SiH](C)C)C=C1 | | CAS DataBase Reference | 2488-01-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Bis(dimethylsilyl)benzene(2488-01-9) | | EPA Substance Registry System | Silane, 1,4-phenylenebis[dimethyl- (2488-01-9) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26-36/37/39-36/37-23 | | RIDADR | 1993 | | WGK Germany | 3 | | RTECS | VV4830000 | | TSCA | Yes | | HS Code | 29319000 |
| | 1,4-Bis(dimethylsilyl)benzene Usage And Synthesis |
| | 1,4-Bis(dimethylsilyl)benzene Preparation Products And Raw materials |
|
