|
| | 2,3-Dimethyl-2,3-diphenylbutane Basic information |
| Product Name: | 2,3-Dimethyl-2,3-diphenylbutane | | Synonyms: | (1,1,2-Trimethyl-2-phenylpropyl)benzene;1,1'-[1,1,2,2-Tetramethyl-1,2-ethandiyl]bis[benzene];1,1’-(1,1,2,2-tetramethyl-1,2-ethanediyl)bis-benzen;1,2-Diphenyltetramethylethane;2,3-Diphenyl-2,3-dimethylbutane;alpha,alpha'-Dicumyl;Bibenzyl, alpha,alpha,alpha',alpha'-tetramethyl-;Butane, 2,3-dimethy-2,3-diphenyl- | | CAS: | 1889-67-4 | | MF: | C18H22 | | MW: | 238.37 | | EINECS: | 217-568-2 | | Product Categories: | flame retardant additive;Pharmaceutical intermediates Series;Dichloroglyoxime is a newly developed high efficient industrial fungicide | | Mol File: | 1889-67-4.mol |  |
| | 2,3-Dimethyl-2,3-diphenylbutane Chemical Properties |
| Melting point | 90-110 °C | | Boiling point | 335.97°C (estimate) | | density | 0.9859 (estimate) | | vapor pressure | 0.015Pa at 20℃ | | refractive index | 1.5413 (estimate) | | storage temp. | Sealed in dry,2-8°C | | form | Flakes, Crystalline Powder or Chunks | | color | White to light yellow | | Water Solubility | insoluble | | InChI | InChI=1S/C18H22/c1-17(2,15-11-7-5-8-12-15)18(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3 | | InChIKey | HGTUJZTUQFXBIH-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(C)(C)C(C1=CC=CC=C1)(C)C | | LogP | 6.68 at 25℃ | | NIST Chemistry Reference | Benzene, 1,1'-(1,1,2,2-tetramethyl-1,2-ethanediyl)bis-(1889-67-4) | | EPA Substance Registry System | 2,3-Dimethyl-2,3-diphenylbutane (1889-67-4) |
| Safety Statements | 24/25 | | HS Code | 29029090 |
| | 2,3-Dimethyl-2,3-diphenylbutane Usage And Synthesis |
| Chemical Properties | white to light yellow flakes, crystalline powder | | Uses | Dicumene is an environment friendly replacement for Antimony Tri-oxide (Sb2O3) and is commonly used as a flame retardant (FR) synergist for polypropylene and polystyrene, especially in expandable polystyrene (EPS). | | Flammability and Explosibility | Nonflammable |
| | 2,3-Dimethyl-2,3-diphenylbutane Preparation Products And Raw materials |
|
