|
| 1-Ethylcyclopentanol Basic information |
| 1-Ethylcyclopentanol Chemical Properties |
Melting point | -10°C(lit.) | Boiling point | 153°C(lit.) | density | 0.909 g/mL at 25 °C | Fp | 49°(120°F) | refractive index | 1.4570 | storage temp. | 2-8°C | pka | 15.38±0.20(Predicted) | form | Liquid | color | Colorless to yellow | Sensitive | Moisture Sensitive | InChI | InChI=1S/C7H14O/c1-2-7(8)5-3-4-6-7/h8H,2-6H2,1H3 | InChIKey | LPCWIFPJLFCXRS-UHFFFAOYSA-N | SMILES | C1(CC)(O)CCCC1 | CAS DataBase Reference | 1462-96-0(CAS DataBase Reference) | NIST Chemistry Reference | Cyclopentanol, 1-ethyl-(1462-96-0) |
Hazard Codes | Xn | Risk Statements | 10-22-36 | Safety Statements | 26 | RIDADR | UN 1993C 3 / PGIII | WGK Germany | 3 | HS Code | 2906.19.5000 | HazardClass | 3 | PackingGroup | III |
| 1-Ethylcyclopentanol Usage And Synthesis |
Chemical Properties | Colorless to light yellow liquid. | Uses | 1-Ethylcyclopentanol is a cyclic alcohol used in the production of cyclopentanol derivatives. These derivatives serve as intermediates for agrochemicals, pharmaceuticals, and flavors. | Preparation | When Grignard reagent (CH3CH2-Mgl) is added to ketone (C5H8O), it attacks the carbonyl carbon of ketone, and after protonation, it results in tertiary alcohol.
 Synthesis of 1-ethylcyclopentanol |
| 1-Ethylcyclopentanol Preparation Products And Raw materials |
|