|
| | zinc diricinoleate Basic information |
| Product Name: | zinc diricinoleate | | Synonyms: | 9-Octadecenoic acid, 12-hydroxy-, zinc salt (2:1), (9Z,12R)-;Zinc ricinolate;Bis[(9Z,12R)-12-hydroxy-9-octadecenoic acid]zinc salt;Bisricinoleic acid zinc salt;Zinc(II) (R,E)-12-hydroxyoctadec-9-enoate;zinc diricinoleate;ZINC RICINOLEATE;zinc diricinoleate2 | | CAS: | 13040-19-2 | | MF: | C18H34O3Zn | | MW: | 363.85 | | EINECS: | 235-911-4 | | Product Categories: | 13040-19-2 | | Mol File: | 13040-19-2.mol |  |
| | zinc diricinoleate Chemical Properties |
| density | 1.095[at 20℃] | | Odor | wh. fine powd., fatty acid odor | | InChI | InChI=1/C18H34O3.Zn/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);/b12-9-;/t17-;/s3 | | InChIKey | OIJQSPQODYCEJI-UVTPQHRRNA-N | | SMILES | [C@@H](O)(CCCCCC)C/C=C\CCCCCCCC(=O)O.[Zn] |&1:0,r| | | LogP | 5.701 (est) | | EPA Substance Registry System | 9-Octadecenoic acid, 12-hydroxy-, zinc salt (2:1), (9Z,12R)- (13040-19-2) |
| | zinc diricinoleate Usage And Synthesis |
| Description | Zinc diricinoleate is the zinc salt of ricinoleic acid, a major fatty acid found in castor oil. It is used in many deodorants as an odor-adsorbing agent. | | Chemical Properties | Fine white powder; faint fatty acid odor.
Mp 92–95C, d 1.10 (25/25C). Combustible. | | Uses | Fungicide, emulsifier, greases, lubricants,
waterproofing, lubricating-oil additive, stabilizer in
vinyl compounds. | | Physiological effects | The metal ion zinc in zinc ricinoleate reacts with the fatty acid esters in the skin and forms a protective layer that prevents the skin from becoming dry or irritated.It also inhibits bacterial growth by preventing the synthesis of proteins needed for cell division. |
| | zinc diricinoleate Preparation Products And Raw materials |
|
