|
| Bis(4-aminophenoxy)ethane Basic information |
Product Name: | Bis(4-aminophenoxy)ethane | Synonyms: | 1,2-Bis(p-aminophenoxy)ethane;Bis(4-aminophenoxy)ethane;4,4''-ETHANEDIYLDIOXYDIANILINE ,98%;4,4''-[ETHANE-1,2-DIYLBIS(OXY)]DIANILINE;Benzenamine, 4,4'-[1,2-ethanediylbis(oxy)]bis-;4-[2-(4-aminophenoxy)ethoxy]aniline | CAS: | 6052-10-4 | MF: | C14H16N2O2 | MW: | 244.29 | EINECS: | | Product Categories: | | Mol File: | 6052-10-4.mol | |
| Bis(4-aminophenoxy)ethane Chemical Properties |
Melting point | 179 °C(Solv: ethanol (64-17-5)) | Boiling point | 477.2±30.0 °C(Predicted) | density | 1.204±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | pka | 5.40±0.10(Predicted) | InChI | InChI=1S/C14H16N2O2/c15-11-1-5-13(6-2-11)17-9-10-18-14-7-3-12(16)4-8-14/h1-8H,9-10,15-16H2 | InChIKey | HHDFKOSSEXYTJN-UHFFFAOYSA-N | SMILES | C(OC1=CC=C(N)C=C1)COC1=CC=C(N)C=C1 |
| Bis(4-aminophenoxy)ethane Usage And Synthesis |
| Bis(4-aminophenoxy)ethane Preparation Products And Raw materials |
|