|
| | 3,5-Difluorophenylacetic acid Basic information | | Uses |
| | 3,5-Difluorophenylacetic acid Chemical Properties |
| Melting point | 68-70 °C (lit.) | | Boiling point | 219°C (rough estimate) | | density | 1.3010 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.90±0.10(Predicted) | | color | White to Light yellow | | BRN | 3605064 | | InChI | InChI=1S/C8H6F2O2/c9-6-1-5(3-8(11)12)2-7(10)4-6/h1-2,4H,3H2,(H,11,12) | | InChIKey | IGGNSAVLXJKCNH-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 105184-38-1(CAS DataBase Reference) |
| | 3,5-Difluorophenylacetic acid Usage And Synthesis |
| Uses | 3,5-Difluorophenylacetic acid is used in the biological study of the inhibition of penicillin biosynthetic enzymes by phenylacetic acid halogen derivatives, preparation and in vitro cytotoxic activities of sorafenib derivatives. | | Chemical Properties | light yellow crystalline powder | | Uses | 3,5-Difluorophenylacetic acid has been used in the synthesis of:
- N-[N-(3,5-difluorophenylacetyl)-L-alanyl]-L-phenylglycine tert-butyl ester
- N-acylalanine
| | General Description | 3,5-Difluorophenylacetic acid is an important pharmaceutical intermediate. |
| | 3,5-Difluorophenylacetic acid Preparation Products And Raw materials |
|
