|
| | Ketone Ester Basic information |
| Product Name: | Ketone Ester | | Synonyms: | Ketone Ester;(3R)-3-Hydroxybutanoic acid (3R)-3-hydroxybutyl ester;BD-AcAc 2;[(3R)-3-hydroxybutyl] (3R)-3-hydroxybutanoate;R-BHB;Butanoic acid, 3-hydroxy-, (3R)-3-hydroxybutyl ester, (3R)-;(R)-(R)-3-hydroxybutyl 3-hydroxybutanoate;(R)-3-hydroxybutyl (R)-3-hydroxybutyrate | | CAS: | 1208313-97-6 | | MF: | C8H16O4 | | MW: | 176.21 | | EINECS: | | | Product Categories: | 1208313-97-6 | | Mol File: | 1208313-97-6.mol |  |
| | Ketone Ester Chemical Properties |
| Boiling point | 269℃ | | density | 1.102 | | Fp | 101℃ | | storage temp. | Store at -20°C | | solubility | Methyl Acetate: 50 mg/ml | | pka | 14.38±0.20(Predicted) | | InChI | InChI=1S/C8H16O4/c1-6(9)3-4-12-8(11)5-7(2)10/h6-7,9-10H,3-5H2,1-2H3/t6-,7-/m1/s1 | | InChIKey | AOWPVIWVMWUSBD-RNFRBKRXSA-N | | SMILES | C(OCC[C@H](O)C)(=O)C[C@H](O)C |
| | Ketone Ester Usage And Synthesis |
| Uses | Ketone ester is exogenous ketone bodies that may promote ketosis in humans. Studies on animals have shown that ketone esters can have positive effects on Alzheimer's disease by decreasing amyloid buildup, reducing neurofibrillary tangles and tau, and enhancing learning and memory. | | Preparation | Ketone ester can be prepared by reacting (3R)-3-hydroxybutyl methyl ester with tert-butyl dimethylchlorosilane.
 | | benefits | Ketone esters can help with muscle recovery after exercising. They increase the rate of energy store replenishment in the body and support the process of rebuilding muscles. They also decrease the amount of muscle breakdown. The various forms of ketone esters that have been utilized include R,S-1,3-butanediol diacetoacetate (BD-AcAc2, ketone diester), D-β-hydroxybutyrate-(R)-1,3 butanediol (ketone monoester), and Bis-hexanoyl (R)-1,3-butanediol (BH-BD), among others.? | | Biological Activity | Ketone ester–enriched diets that induce sustained ketonemia reduce pathological cardiac remodeling and enhance ventricular function in multiple heart failure models across both mice and rats using both prevention and treatment strategies. |
| | Ketone Ester Preparation Products And Raw materials |
|
