|
| | cis-3-Hydroxycyclobutanecarboxylic acid Basic information |
| Product Name: | cis-3-Hydroxycyclobutanecarboxylic acid | | Synonyms: | Cyclobutanecarboxylic acid, 3-hydroxy-, cis-;3-hydroxy-1-cyclobutanecarboxylic acid;3-hydroxycyclobutane-1-carboxylic acid;N-Carbamimidoylisonicotinamide;cis-3-Hydroxycyclobutanecarboxylic acid;(1s,3s)-3-Hydroxycyclobutanecarboxylic acid;3-hydroxycyclobutane-1-carboxylic acid,cis- | | CAS: | 552849-33-9 | | MF: | C5H8O3 | | MW: | 116.12 | | EINECS: | | | Product Categories: | | | Mol File: | 552849-33-9.mol |  |
| | cis-3-Hydroxycyclobutanecarboxylic acid Chemical Properties |
| Boiling point | 290.1±33.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.54±0.40(Predicted) | | InChI | InChI=1S/C5H8O3/c6-4-1-3(2-4)5(7)8/h3-4,6H,1-2H2,(H,7,8)/t3-,4+ | | InChIKey | ZSHGVMYLGGANKU-ZXZARUISSA-N | | SMILES | [C@@H]1(C(O)=O)C[C@H](O)C1 |
| | cis-3-Hydroxycyclobutanecarboxylic acid Usage And Synthesis |
| Uses | Cis-3-Hydroxycyclobutanecarboxylic acid is a non-natural amino acid and a positron-emitting radiotracer. It is used in the preparation of PET imaging agents for the detection of human tumors. It has been shown to be a more sensitive marker than FDG, which is typically used in tumor imaging. The labeling of this compound can be done on a large scale by automated means, making it an ideal candidate for use in PET imaging studies with high stereoselectivity. |
| | cis-3-Hydroxycyclobutanecarboxylic acid Preparation Products And Raw materials |
|
