|
| Product Name: | MK-677 | | Synonyms: | 2-Amino-N-[(1R)-2-[1,2-dihydro-1-(methylsulfonyl)spiro[3H-indole-3,4'-piperidin]-1'-yl]-2-oxo-1-[(phenylmethoxy)methyl]ethyl]-2-methylpropanamide methanesulfonate;MK677（Ibutamoren Mesylate）;MK-677; CRESCENDO; MK 0677; MK-0677; MK0677;MK677;MK 677;CS-1402;MK677 MK 677 IBUTAMOREN;mk677 mk 677 Ibutamoren,whnohe_lucy(at)163.com;MK677,Mk677;MK-677 Selective Androgen Receptor Modulators SARMs Bodybuilding CAS 159752-10-0 | | CAS: | 159752-10-0 | | MF: | C28H40N4O8S2 | | MW: | 624.77 | | EINECS: | 1308068-626-2 | | Product Categories: | SARMs(Selective androgen receptor modulator);API;159752-10-0 | | Mol File: | 159752-10-0.mol |  |
| | MK-677 Chemical Properties |
| Melting point | 164-170°C | | storage temp. | 2-8°C | | solubility | H2O: soluble5mg/mL, clear | | form | powder | | color | white to beige | | InChIKey | DUGMCDWNXXFHDE-VZYDHVRKSA-N | | SMILES | S(O)(=O)(=O)C.S(N1C2C=CC=CC=2C2(CCN(C(=O)[C@H](NC(=O)C(N)(C)C)COCC3C=CC=CC=3)CC2)C1)(=O)(=O)C |&1:19,r| |
| WGK Germany | 3 | | RTECS | TX1404490 |
| | MK-677 Usage And Synthesis |
| Description | MK-677 (also known as ibutamoren), promotes the secretion of the growth hormone (GH) and increases insulin-like growth factor 1 (IGF-1). Ibutamoren increases growth hormone levels by mimicking the action of the hormone ghrelin and binding to one of the ghrelin receptors (GHSR) in the brain. Activated GHSR stimulates growth hormone release from the brain. Clinical studies describe only the effects ibutamoren has on appetite and as expected, like ghrelin, ibutamoren increases it. GHSR is found in brain regions that control appetite, pleasure, mood, biological rhythms, memory, and cognition. | | Benefits | The benefits of MK-677 include muscle-building, a reduction in muscle wasting, better bone density, improved sleep, and anti-aging properties. It may also have nootropic effects and it can be beneficial in treating growth hormone deficiencies. Read on for a more in-depth look at these benefits.
| | Uses |
Growth
hormone releasing factor.MK-677 is a potent, non-peptide ghrelin receptor agonist.
| | Biochem/physiol Actions | It is also known as ibutamoren mesylate. MK-677 is a mimic of growth hormone (GH)-releasing peptide and is orally active. | | Side effects | Reported side effects of MK-677 are typically the result of unnaturally high levels of growth hormone in the body from taking too much too often, which include:
Increased appetite
Lethargy
Joint pain if you have previous medical conditions or elevated hormone levels
Insulin resistance
Possible increase in prolactin levels, which can be controlled
When dosed properly, the side effects of MK-677 are minimal to none compared to the results you get from taking it properly. | | storage | Store at -20°C |
| | MK-677 Preparation Products And Raw materials |
|
