|
| 1,3-Bis(diphenylphosphino)propane Basic information |
| 1,3-Bis(diphenylphosphino)propane Chemical Properties |
Melting point | 63-65 °C (lit.) | Boiling point | 529.7±33.0 °C(Predicted) | Fp | 235°C | storage temp. | Inert atmosphere,Room Temperature | form | Granules or Powder | color | White to light yellow-beige | Water Solubility | insoluble | Sensitive | Air Sensitive | BRN | 2821785 | InChI | InChI=1S/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2 | InChIKey | LVEYOSJUKRVCCF-UHFFFAOYSA-N | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)CCCP(C1C=CC=CC=1)C1C=CC=CC=1 | CAS DataBase Reference | 6737-42-4(CAS DataBase Reference) | NIST Chemistry Reference | 1,3-Bis(diphenylphosphino)propane(6737-42-4) | EPA Substance Registry System | Phosphine, 1,3-propanediylbis[diphenyl- (6737-42-4) |
| 1,3-Bis(diphenylphosphino)propane Usage And Synthesis |
Chemical Properties | white to light yellow crystal powde | Uses | 1,3-Bis(diphenylphosphino)propane is used as a bidentate ligand in coordination chemistry and form complex dichloro(1,3-bis(diphenylphosphino)propane)nickel by reacting with nickel(II) chloride. This complex is used as a catalyst for Kumada coupling reaction. It also acts as a ligand for palladium(II) catalysts which is useful for the co-polymerization of carbon monoxide and ethylene to get polyketones. Further, it is employed in palladium-catalyzed arylation under Heck reaction and Suzuki reaction. In addition to this, it serves as a catalyst for Negishi coupling and Sonogashira coupling reactions. |
| 1,3-Bis(diphenylphosphino)propane Preparation Products And Raw materials |
|