|
| | Oroxylin A Basic information |
| Product Name: | Oroxylin A | | Synonyms: | 5,7-Dihydroxy-6-methoxy-2-phenyl-4H-1-benzopyran-4-one;5,7-Dihydroxy-6-methoxyflavone;Oroxylia A;6-Methoxybaicalein;Baicalein 6-methyl ether;Oroxylin;OLOXYLINA;oxoxylin A | | CAS: | 480-11-5 | | MF: | C16H12O5 | | MW: | 284.26 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 480-11-5.mol |  |
| | Oroxylin A Chemical Properties |
| Melting point | 195-197℃ | | Boiling point | 346.76°C (rough estimate) | | density | 1.420 | | refractive index | 1.6200 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:4): 0.20 mg/ml | | form | powder | | pka | 6.48±0.40(Predicted) | | color | Yellow | | InChI | InChI=1S/C16H12O5/c1-20-16-11(18)8-13-14(15(16)19)10(17)7-12(21-13)9-5-3-2-4-6-9/h2-8,18-19H,1H3 | | InChIKey | LKOJGSWUMISDOF-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1 |
| Hazard Codes | Xn | | Risk Statements | 22 |
| | Oroxylin A Usage And Synthesis |
| Definition | ChEBI: A dihydroxy- and monomethoxy-flavone in which the hydroxy groups are positioned at C-5 and C-7 and the methoxy group is at C-6. |
| | Oroxylin A Preparation Products And Raw materials |
| Raw materials | 2-Propen-1-one, 3-phenyl-1-(2,4,6-trihydroxy-3-methoxyphenyl)-, (2E)--->Wogonin-->Oroxylin A 7-O-beta-D-glucuronide methyl ester-->4H-1-Benzopyran-4-one, 7-hydroxy-5,6-dimethoxy-2-phenyl--->(2E)-1-(6-hydroxy-2,3,4-trimethoxyphenyl)-3-phenylprop-2-en-1-one-->Baicalein-->MOSLOFLAVONE-->3,4,5-Trimethoxyphenol-->5,6,7-TRIMETHOXYFLAVONE-->Baicalin-->2,3,4-TRIMETHOXY-6-HYDROXYACETOPHENONE-->Dimethyl sulfate-->Iodomethane-->Cinnamoyl chloride |
|
