|
| 1-Pentanone, 4-methyl-1-phenyl-2-(1-pyrrolidinyl)- Basic information |
| 1-Pentanone, 4-methyl-1-phenyl-2-(1-pyrrolidinyl)- Chemical Properties |
Boiling point | 350.6±25.0 °C(Predicted) | density | 1.017±0.06 g/cm3(Predicted) | solubility | Chloroform (Slightly), Methanol (Slightly) | pka | 8.49±0.20(Predicted) | form | Solid | color | Off-White to Light Brown | Stability: | Hygroscopic | InChI | InChI=1S/C16H23NO/c1-13(2)12-15(17-10-6-7-11-17)16(18)14-8-4-3-5-9-14/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3 | InChIKey | UOZWZANRCOALQL-UHFFFAOYSA-N | SMILES | C(C1=CC=CC=C1)(=O)C(N1CCCC1)CC(C)C |
| 1-Pentanone, 4-methyl-1-phenyl-2-(1-pyrrolidinyl)- Usage And Synthesis |
Uses | a-Pyrrolidinoisohexanophenone (Hydrochloride) is a phenone derivative used for research purposes. |
| 1-Pentanone, 4-methyl-1-phenyl-2-(1-pyrrolidinyl)- Preparation Products And Raw materials |
|