|
| | 4'-ethynyl-2-fluoro-2'-deoxyadenosine Basic information |
| Product Name: | 4'-ethynyl-2-fluoro-2'-deoxyadenosine | | Synonyms: | 4'-ethynyl-2-fluoro-2'-deoxyadenosine;E2FDA;EFdA;2'-deoxy-4'-C-ethynyl-2-fluoro-Adenosine;2'-Deoxy-4'-ethynyl-2-fluoroadenosine;4'-ethynyl-2-fluoro-2'-deoxyadenosine EFDA E2FDA;Islatravir;Adenosine Related Compound | | CAS: | 865363-93-5 | | MF: | C12H12FN5O3 | | MW: | 293.25 | | EINECS: | | | Product Categories: | | | Mol File: | 865363-93-5.mol |  |
| | 4'-ethynyl-2-fluoro-2'-deoxyadenosine Chemical Properties |
| Melting point | 220.0-221.4 °C (decomp) | | Boiling point | 669.2±65.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:100.0(Max Conc. mg/mL);341.0(Max Conc. mM)
Water:3.57(Max Conc. mg/mL);12.17(Max Conc. mM) | | form | A solid | | pka | 13.11±0.60(Predicted) | | InChI | InChI=1S/C12H12FN5O3/c1-2-12(4-19)6(20)3-7(21-12)18-5-15-8-9(14)16-11(13)17-10(8)18/h1,5-7,19-20H,3-4H2,(H2,14,16,17)/t6-,7+,12+/m0/s1 | | InChIKey | IKKXOSBHLYMWAE-QRPMWFLTSA-N | | SMILES | OC[C@@]1(C#C)O[C@@H](N2C3C(=C(N=C(F)N=3)N)N=C2)C[C@@H]1O |
| | 4'-ethynyl-2-fluoro-2'-deoxyadenosine Usage And Synthesis |
| Uses | 4'-ethynyl-2-fluoro-2'-deoxyadenosine is a heterocyclic organic compound and can be used as pharmaceutical intermediates. | | Uses | MK-?8591 is a carbocyclic nucleoside reverse transcriptase translocation inhibitor and is used as an antiviral with potential use towards the treatment of HIV. |
| | 4'-ethynyl-2-fluoro-2'-deoxyadenosine Preparation Products And Raw materials |
|
