|
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Basic information |
| Product Name: | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione | | Synonyms: | 4,7-Methano-1H-isoindole-1,3(2H)-dione, hexahydro-, (3aR,4S,7R,7aS)-rel-;(3aR,4S,7R,7aS)-Hexahydro-1H-4,7-Methanoisoindole-1,3(2H)-dione;(3aR,4S,7R,7aS)-rel-Hexahydro-4,7-Methano-1H-isoindole-;exo-2,3-NorbornanedicarboxiMide;(3aR,7aS)-rel-hexahydro-4,7-Methano-1H-isoindole-1,3(2H)-dione (relative stereo structure));Bicyclo[2,2,1]heptane-2,3-di-exo-carboximide;Lurasidone INT 1;Bicyclo[2.2.1]hep-tane-2,3-exo- dicarboximide | | CAS: | 14805-29-9 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | 689-268-3 | | Product Categories: | | | Mol File: | 14805-29-9.mol |  |
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Chemical Properties |
| Melting point | 173-176℃ | | Boiling point | 355℃ | | density | 1.285 | | Fp | 171℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 11.85±0.20(Predicted) | | form | Solid | | color | White to Light Brown | | InChI | InChI=1/C9H11NO2/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8/h4-7H,1-3H2,(H,10,11,12)/t4-,5+,6+,7- | | InChIKey | RIVOBMOBWMOLDJ-RNGGSSJXNA-N | | SMILES | C1(=O)[C@]2([H])[C@@]([H])([C@]3([H])C[C@@]2([H])CC3)C(=O)N1 |&1:2,4,6,9,r| |
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Usage And Synthesis |
| Uses | (3AR,4S,7R,7AS) 4,7-methylene-1H-isoindole-1,3(2H)-dione can be used as an intermediate for organic synthesis and pharmaceutical research and development, suitable for laboratory organic synthesis It can be used as the raw material for the synthetic raw material medicine lurasidone in the synthesis process of chemical medicine. | | Uses | exo-2,3-Norbornanedicarboximide is a Lurasidone (L474920) intermediate. |
| | (3aR,4S,7R,7aS) 4,7-Methano-1H-isoindole-1,3(2H)-dione Preparation Products And Raw materials |
|
