|
| | m-(Trifluoromethyl)phenylacetic acid Basic information |
| | m-(Trifluoromethyl)phenylacetic acid Chemical Properties |
| Melting point | 76-79 °C(lit.) | | Boiling point | 238C/775Torr | | density | 1.357±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.14±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 2213223 | | InChI | InChI=1S/C9H7F3O2/c10-9(11,12)7-3-1-2-6(4-7)5-8(13)14/h1-4H,5H2,(H,13,14) | | InChIKey | BLXXCCIBGGBDHI-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 351-35-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzeneacetic acid, 3-(trifluoromethyl)- (351-35-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | TSCA | T | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | m-(Trifluoromethyl)phenylacetic acid Usage And Synthesis |
| Chemical Properties | white to pale yellow crystalline powder | | Uses | 3-(Trifluoromethyl)phenylacetic acid is used as a reactant in a mechanistic study on ligand-accelerated C-H activation reactions. |
| | m-(Trifluoromethyl)phenylacetic acid Preparation Products And Raw materials |
|
