|
| | 2,2'-Cyclouridine Basic information |
| Product Name: | 2,2'-Cyclouridine | | Synonyms: | O2,2'-CYCLOURIDINE;2,2'-ANHYDRO-1(BETA-D-ARABINOFURANOSYL)URACIL;2,2'-ANHYDROURIDINE;2, 2'-ANHYDRO-1-(B-D-ARABINOFURANOSYL) URACIL;2,2'-Cyclouridine;BETA-D-O(2),2'-CYCLOURIDINE;02,2-Cycloridine;[2R-(2alpha,3beta,3abeta,9abeta)]-2,3,3a,9a-tetrahydro-3-hydroxy-(hydroxymethyl)-6H-furo[2',3':4,5]oxazolo[3,2-a]pyrimidin-6-one | | CAS: | 3736-77-4 | | MF: | C9H10N2O5 | | MW: | 226.19 | | EINECS: | 223-107-6 | | Product Categories: | Building Blocks;C9 to C11;Heterocyclic Building Blocks;Pyrimidines;Chemical Synthesis;Heterocyclic Building Blocks;Heterocyclic Compounds;Biochemistry;Nucleosides and their analogs;Nucleosides, Nucleotides & Related Reagents;Building Blocks;3736-77-4 | | Mol File: | 3736-77-4.mol |  |
| | 2,2'-Cyclouridine Chemical Properties |
| Melting point | 248-251 °C(lit.) | | alpha | -21°(19℃, c=4, H2O) | | Boiling point | 456.3±55.0 °C(Predicted) | | density | 2.01±0.1 g/cm3(Predicted) | | refractive index | -20 ° (C=4, H2O) | | storage temp. | -20°C | | solubility | DMSO:2.0(Max Conc. mg/mL);8.84(Max Conc. mM)
PBS (pH:7.2):1.0(Max Conc. mg/mL);4.42(Max Conc. mM) | | pka | 12.55±0.40(Predicted) | | form | powder to crystal | | color | White to Almost white | | optical activity | [α]19/D 21°, c = 4 in H2O | | InChI | InChI=1S/C9H10N2O5/c12-3-4-6(14)7-8(15-4)11-2-1-5(13)10-9(11)16-7/h1-2,4,6-8,12,14H,3H2/t4-,6-,7+,8-/m1/s1 | | InChIKey | UUGITDASWNOAGG-CCXZUQQUSA-N | | SMILES | C12O[C@@]3([H])[C@H](O)[C@@H](CO)O[C@@]3([H])N1C=CC(=O)N=2 | | CAS DataBase Reference | 3736-77-4 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | 2,2'-Cyclouridine Usage And Synthesis |
| Description | 2,2'-Anhydro-1(B-D-arabinofuranosyl)uracil is a research tool for anticancer and antiviral studies. This works by inhibiting uridine phosphorylase, a key enzyme targeted by some antitumor drugs. | | Chemical Properties | White powder | | Uses | O2,2''-Cyclouridine is a research tool for anticancer and antiviral studies. | | Uses | Research tool for antiviral and anticancer studies.1 |
| | 2,2'-Cyclouridine Preparation Products And Raw materials |
|
