|
| | 2-Methoxyphenylboronic acid Basic information |
| | 2-Methoxyphenylboronic acid Chemical Properties |
| Melting point | 105-110 °C (lit.) | | Boiling point | 319.3±44.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 8.55±0.58(Predicted) | | form | Crystals or Crystalline Powder | | color | Off-white | | Water Solubility | Insoluble in water. | | BRN | 3030981 | | InChI | InChI=1S/C7H9BO3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5,9-10H,1H3 | | InChIKey | ROEQGIFOWRQYHD-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC=C1OC)(O)O | | CAS DataBase Reference | 5720-06-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 2-Methoxyphenylboronic acid Usage And Synthesis |
| Description | 2-Methoxyphenylboronic acid is an arylboronic acid. Arylboronic acids can be widely used as safe and environmentally friendly new aromatization reagents for scientific research and production of various fine chemicals containing aryl structures, such as pharmaceuticals, pesticides, and advanced materials. The reactions of arylboronic acids with halogenates play a pivotal role in today's drug synthesis, and such reactions were pioneered by Japanese scientists Suzuki's team, which won the Nobel Prize in Chemistry in 2010. | | Chemical Properties | white to light yellow crystal powder | | Uses | 2-Methoxylphenylboronic acid is a phenylboronic acid used to investigate boron function in plants. It is used in Suzuki reaction, organic reaction that is classified as a coupling reaction where the coupling partners are a boronic acid with a halide catalyzed by a palladium(0) complex. | | Preparation | Under the protection of nitrogen, add magnesium (2.9 g, 1.2 times) and tetrahydrofuran (20 ml) and dibromoethane (1.9 g) to a 250 ml three-necked flask with a dropping funnel; then add 2-methoxybromobenzene (17.1 g, 0.1 mol), trimethyl borate (36.8 g, 3.5 times) and tetrahydrofuran (50 ml) as solvent to the dropping funnel. Heat to 40 ℃, activate the magnesium powder, and then slowly add the mixture in the dropping funnel dropwise, control the speed to the reaction temperature does not exceed 60 ℃, add the reaction after stirring until the magnesium basically disappeared, and then heat the reflux reaction for 6 hours. Stop heating, cool to room temperature, hydrolyze with 5% dilute hydrochloric acid to pH<2. Distillation to recover THF solvent, as the solvent is reduced, the product precipitated; cooling and filtration, recrystallization in methanol/water can be obtained 2-methoxyphenylboronic acid. |
| | 2-Methoxyphenylboronic acid Preparation Products And Raw materials |
|
