|
| 1-(3-CHLOROPROPYL)THEOBROMINE Basic information |
Product Name: | 1-(3-CHLOROPROPYL)THEOBROMINE | Synonyms: | 1-(3-CHLOROPROPYL)-3,7-DIHYDRO-3,7-DIMETHYL-1H-PURINE-2,6-DIONE;1-(3-CHLOROPROPYL)-3,7-DIMETHYLXANTHINE;1-(3-CHLOROPROPYL)THEOBROMINE;Chloropropyltheobromine;1-(3-Chloropropyl)-3,7-dihydro-3,7-dimethyl-1H-purine-2,6-dione
1-(3-Chloropropyl)-3,7-dimethylxanthine;1-(3-Chloropropyl)-3,7-diMethyl-1H-purine-2,6(3H,7H)-dione;1-(3-Chloro-propyl)-3,7-diMethyl-3,7-dihydro-purine-2,6-dione;1H-Purine-2,6-dione,1-(3-chloropropyl)-3,7-dihydro-3,7-diMethyl- | CAS: | 74409-52-2 | MF: | C10H13ClN4O2 | MW: | 256.69 | EINECS: | | Product Categories: | Alkaloids;Alkaloids (Others);Biochemistry | Mol File: | 74409-52-2.mol |  |
| 1-(3-CHLOROPROPYL)THEOBROMINE Chemical Properties |
Melting point | 145°C | Boiling point | 478.2±51.0 °C(Predicted) | density | 1.45 | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | form | Solid | pka | 0.47±0.70(Predicted) | color | White | Stability: | Moisture Sensitive | InChI | InChI=1S/C10H13ClN4O2/c1-13-6-12-8-7(13)9(16)15(5-3-4-11)10(17)14(8)2/h6H,3-5H2,1-2H3 | InChIKey | JMOWKXFNJSTXBW-UHFFFAOYSA-N | SMILES | N1(C)C2=C(N(C)C(=O)N(CCCCl)C2=O)N=C1 |
Safety Statements | 22-24/25 | HS Code | 2939.80.0000 |
| 1-(3-CHLOROPROPYL)THEOBROMINE Usage And Synthesis |
| 1-(3-CHLOROPROPYL)THEOBROMINE Preparation Products And Raw materials |
|