|
| | 1,3,5-Cyclohexanetricarboxylic acid Basic information |
| Product Name: | 1,3,5-Cyclohexanetricarboxylic acid | | Synonyms: | CIS-1,3,5-CYCLOHEXANETRICARBOXYLIC ACID;CIS,CIS-1,3,5-CYCLOHEXANETRICARBOXYLIC ACID;1,3,5-CYCLOHEXANETRICARBOXYLIC ACID;(1ALPHA,3ALPHA,5ALPHA)-1,3,5-CYCLOHEXANETRICARBOXYLIC ACID;-TRIOL 3-ACETATE METHYL ESTER;4-CHOLESTEN-2α;21-DIOL-20-ONE 3-STEARATE;-OL-3-ONE 3-CARBOXYMETHYLOXIME | | CAS: | 16526-68-4 | | MF: | C9H12O6 | | MW: | 216.19 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 16526-68-4.mol |  |
| | 1,3,5-Cyclohexanetricarboxylic acid Chemical Properties |
| Melting point | 216-220 °C | | Boiling point | 372.4±42.0 °C(Predicted) | | density | 1.509±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.45±0.10(Predicted) | | color | White to Almost white | | BRN | 3120108 | | InChI | InChI=1/C9H12O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5+,6- | | InChIKey | FTHDNRBKSLBLDA-FPFOFBBKSA-N | | SMILES | [C@@H]1(C(=O)O)C[C@@H](C[C@H](C(=O)O)C1)C(=O)O |&1:0,5,7,r| | | CAS DataBase Reference | 16526-68-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29172090 |
| | 1,3,5-Cyclohexanetricarboxylic acid Usage And Synthesis |
| Uses | Used as an organic intermediate. | | Synthesis | A mixture of 18 g (85 mmol) of trimesic acid, 2 g (10% mass equiv) of 5% rhodium on alumina,22 and 300 mL of water was hydrogenated at 70 °C and 50 psi. Uptake was complete in 7 h and the yield was almost quantitative. The filtrate was concentrated to give a white solid. The acid obtained was mostly the cis,cis form (cis,cis/cis,trans = 7:1). Recrystalization from ethanol-toluene solution gave the cis,cis isomer, 1,3,5-Cyclohexanetricarboxylic acid, quantitative yield mp 218-219 °C (lit.23 mp 218 °C); 1H NMR (500 MHz, CDCl3) δ11.51 (br s, 3H), 1.91 (dd, J = 5.5 Hz, J = 5.0 Hz, 3H), 1.83 (dd, J = 13.0 Hz, J = 5.0 Hz, 3H), 1.02 (dd, J = 13.0 Hz, J = 5.5 Hz, 3H); 13C NMR (500 MHz, CDCl3) δ175.44, 40.79, 29.91; IR (cm-1) 2917, 2850, 1708, 1616, 1418, 1289, 1261.
 | | Purification Methods | Purify it also by conversion to the triethyl ester b 217-218o/10mm, 151o/1mm, the distillate solidifies on cooling, m 36-37o, which is hydrolysed by boiling in aqueous HCl. The trimethyl ester can be distilled and recrystallised from Et2O, m 48-49o. [Newman & Lawrie J Am Chem Soc 76 4598 1954, Lukes &S Galik Coll Czech Chem Comm 19 712 1954, Beilstein 9 III 4749.] |
| | 1,3,5-Cyclohexanetricarboxylic acid Preparation Products And Raw materials |
|
