|
| | 2',3'-O-Isopropylideneadenosine Basic information |
| Product Name: | 2',3'-O-Isopropylideneadenosine | | Synonyms: | 6-Amino-9-(2-O,3-O-isopropylidene-β-D-ribofuranosyl)-9H-purine;2',3'-O-Isopropylideneadenosine,98%;2'-O,3'-O-Isopropylideneadenosine;[(3aR,4R,6R,6aR)-6-(6-amino-9H-purin-9-yl)-2,2-dimethyl-tetrahydro-2H-furo[3,4-d][1,3]dioxol-4-yl]methanol;(1R,2R,4R,5R)-2-(6-Amino-9H-purin-9-yl)-4-(hydroxymethyl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,5-diol;9-(2,3-O-Isopropylidene-beta-D-ribofuranosyl)adenin;2,3-Isopropylideneadeosine;2',3'-O-(1-Methylethylidene)adenosine | | CAS: | 362-75-4 | | MF: | C13H17N5O4 | | MW: | 307.31 | | EINECS: | 206-650-3 | | Product Categories: | API intermediates;Biochemistry;Nucleosides and their analogs;Nucleosides, Nucleotides & Related Reagents;Bases & Related Reagents;Nucleotides;Nucleosides;Oligonucleotide Synthesis;Specialty Synthesis | | Mol File: | 362-75-4.mol |  |
| | 2',3'-O-Isopropylideneadenosine Chemical Properties |
| Melting point | 221-222 °C(lit.) | | Boiling point | 447.81°C (rough estimate) | | density | 1.2370 (rough estimate) | | refractive index | -105 ° (C=1, Dioxane) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Dioxane (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) | | pka | 14.14±0.10(Predicted) | | form | Crystalline Powder | | color | White to off-white | | optical activity | [α]20/D 98.5°, c = 1 in dioxane | | BRN | 43435 | | InChI | InChI=1S/C13H17N5O4/c1-13(2)21-8-6(3-19)20-12(9(8)22-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3,(H2,14,15,16)/t6-,8-,9-,12-/m1/s1 | | InChIKey | LCCLUOXEZAHUNS-WOUKDFQISA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)[C@@H]2OC(O[C@H]12)(C)C | | CAS DataBase Reference | 362-75-4(CAS DataBase Reference) | | NIST Chemistry Reference | Adenosine, 2',3'-o-isopropylidene(362-75-4) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | 2',3'-O-Isopropylideneadenosine Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | 2',3'-O-Isopropylideneadenosine is used as an organic chemical synthesis intermediate. |
| | 2',3'-O-Isopropylideneadenosine Preparation Products And Raw materials |
|
