|
| Difunctional alpha hydroxy ketone Basic information |
Product Name: | Difunctional alpha hydroxy ketone | Synonyms: | 2-Hydroxy-1-[4-[4-(2-hydroxy-2-methylpropionyl)phenoxy]phenyl]-2-methylpropanone;1,1’-[Oxybis(4,1-phenylene)]bis(2-hydroxy-2-methyl-1-propanone);Photoinitiator 160;Difunctional alpha hydroxy ketone;KIP 160;HRcure-160;Bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]ether;Photoinitiator KIP 160 | CAS: | 71868-15-0 | MF: | C20H22O5 | MW: | 342.39 | EINECS: | | Product Categories: | | Mol File: | 71868-15-0.mol |  |
| Difunctional alpha hydroxy ketone Chemical Properties |
Boiling point | 514.2±45.0 °C(Predicted) | density | 1.204±0.06 g/cm3(Predicted) | pka | 12.58±0.29(Predicted) | InChI | InChI=1S/C20H22O5/c1-19(2,23)17(21)13-5-9-15(10-6-13)25-16-11-7-14(8-12-16)18(22)20(3,4)24/h5-12,23-24H,1-4H3 | InChIKey | LYGZOGDWCOYSGJ-UHFFFAOYSA-N | SMILES | O(C1=CC=C(C(=O)C(O)(C)C)C=C1)C1=CC=C(C(=O)C(O)(C)C)C=C1 | EPA Substance Registry System | 1-Propanone, 1,1'-(oxydi-4,1-phenylene)bis[2-hydroxy-2-methyl- (71868-15-0) |
| Difunctional alpha hydroxy ketone Usage And Synthesis |
Uses | Difunctional alpha-hydroxyl ketone is a ketone derivative, which can be used as a photoinitiator. |
| Difunctional alpha hydroxy ketone Preparation Products And Raw materials |
Raw materials | 1,1'-(4,4'-oxybis(4,1-phenylene))bis(2-methylpropan-1-one)-->1,1'-(4,4'-oxydi(4,1-phenylene))bis(2-bromo-2-methylpropan-1-one)-->1-Propanone, 1,1'-(oxydi-4,1-phenylene)bis[2-chloro-2-methyl--->4,4'-BIS(BROMOMETHYL)-DIPHENYL ETHER-->4-Tolyl ether-->Diphenyl ether |
|