|
| | N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine Basic information |
| Product Name: | N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine | | Synonyms: | Gefitinib Impurity 2;Gefitinib-6;Gefitinib impurity 5/N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine;4-Quinazolinamine, N-(3-chloro-4-fluorophenyl)-6,7-dimethoxy-;Gefitinib impurities136;Gefitinib Impurity IIQ: What is
Gefitinib Impurity II Q: What is the CAS Number of
Gefitinib Impurity II;N-(3-chloro-4-fluorophenyl)-6,7-
dimethoxyquinazolin-4-amine? (Gefitinib Impurity） | | CAS: | 153437-78-6 | | MF: | C16H13ClFN3O2 | | MW: | 333.74 | | EINECS: | | | Product Categories: | | | Mol File: | 153437-78-6.mol |  |
| | N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine Chemical Properties |
| solubility | Methanol (Slightly), DMSO (Slightly) | | form | Solid | | color | White to Off-White |
| | N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine Usage And Synthesis |
| Uses | O-Desmorpholinopropyl-O-methyl-gefitinib is a anilinoquinazoline derivative of which acts as an inhibitor of tyrosine kinases and found to be allosteric inhibitors of the enzyme frutose 1,6-bisphosphatase. It serves as a lead to further drug design. |
| | N-(3-chloro-4-fluorophenyl)-6 ,7-dimethoxyquinazolin-4-amine Preparation Products And Raw materials |
|
