|
| | 5-chloro-2,3-diphenylpyrazine Basic information |
| | 5-chloro-2,3-diphenylpyrazine Chemical Properties |
| Melting point | 126-128℃ (methanol ) | | Boiling point | 145°C/0.001mmHg(lit.) | | density | 1?+-.0.06 g/cm3(Predicted) | | form | powder to crystal | | pka | -2.16±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C16H11ClN2/c17-14-11-18-15(12-7-3-1-4-8-12)16(19-14)13-9-5-2-6-10-13/h1-11H | | InChIKey | VUGNCPVAXWZTOL-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=NC=C(Cl)N=C1C1=CC=CC=C1 | | CAS DataBase Reference | 41270-66-0 |
| | 5-chloro-2,3-diphenylpyrazine Usage And Synthesis |
| Uses | 2-Chloro-5,6-diphenylpyrazine is a diphenylpyrazine derivative used in a study to determine a novel class of prostacyclin receptor agonists. |
| | 5-chloro-2,3-diphenylpyrazine Preparation Products And Raw materials |
|
