|
| Product Name: | L-Threonic acid magnesium salt | | Synonyms: | L-Threonic acid magnesium;Magnesium Bis[(2R,3S)-2,3,4-trihydroxybutanoate];Bis[(2R,3S)-2,3,4-trihydroxybutanoato-alphaO,alphaO']magnesium;L-Threonic acid magnesium salt;Magnesium (2R,3S)-2,3,4-trihydroxybutanoate;Magnesium L-threonate;L-Threonate Magnesium;magnesium L-Theorate | | CAS: | 778571-57-6 | | MF: | C8H14MgO10 | | MW: | 294.5 | | EINECS: | 1312995-182-4 | | Product Categories: | api;778571-57-6 | | Mol File: | 778571-57-6.mol |  |
| | L-Threonic acid magnesium salt Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/2C4H8O5.Mg/c2*5-1-2(6)3(7)4(8)9;/h2*2-3,5-7H,1H2,(H,8,9);/q;;+2/p-2 | | InChIKey | YVJOHOWNFPQSPP-UHFFFAOYSA-L | | SMILES | C(C1=O[Mg+2]2(O=C(C(O)C(O)CO)[O-]2)[O-]1)(O)C(O)CO |
| | L-Threonic acid magnesium salt Usage And Synthesis |
| Physical Form | Solid | | Physical properties | Appearance:White or almost white powder. | | Uses | Enhance Cognitive, improve body magnesium status, reduce fluctuation in cognitive ability, brain anti-aging, memory improvement. | | Uses | Magnesium(2+) Ion Bis((2r,3s)-2,3,4-Trihydroxybutanoate) is a useful research chemical. | | Uses | Preclinical work demonstrates that L-Threonic Acid Magnesium Salt (LTAMS) administration is associated with neurobiological and neurofunctional effects that could offer clinical benefits in ADHD treatment. | | Application | Raw material of healthcare products.A Dietary Supplement.Laboratory research |
| | L-Threonic acid magnesium salt Preparation Products And Raw materials |
|
