|
| 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Basic information |
Product Name: | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE | Synonyms: | 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE;RARECHEM AL BP 0215;1,3-Dioxolane, 2-(3,4-difluorophenyl)-;2-(3,4-Difluorophenyl)-1,3-dioxolane,98% | CAS: | 773101-62-5 | MF: | C9H8F2O2 | MW: | 186.16 | EINECS: | | Product Categories: | | Mol File: | 773101-62-5.mol |  |
| 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Chemical Properties |
Boiling point | 228.1±40.0 °C(Predicted) | density | 1.298±0.06 g/cm3(Predicted) | InChI | InChI=1S/C9H8F2O2/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h1-2,5,9H,3-4H2 | InChIKey | JDIKHNSLOQHKLX-UHFFFAOYSA-N | SMILES | O1CCOC1C1=CC=C(F)C(F)=C1 | CAS DataBase Reference | 773101-62-5 |
| 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Usage And Synthesis |
Uses | 2-(3,4-difluorophenyl)-1,3-dioxolane is an organofluorine compound and is used as an organic reagent. |
| 2-(3,4-DIFLUOROPHENYL)-1,3-DIOXOLANE Preparation Products And Raw materials |
|