|
| | D-(+)-CHIRO-INOSITOL Basic information |
| Product Name: | D-(+)-CHIRO-INOSITOL | | Synonyms: | D-(+)-CHIRO-INOSITOL;D-CHIRO-INOSITOL;D-(+)-CHIRO-INOSITOL, 95% (96% EE/GLC);(1R)-Cyclohexane-1r,2c,3t,4c,5t,6t-hexaol;1,2,4/3,5,6-hexahydroxycyclohexane;D-CHIRO-INOSITOL(DISD);chiro-Inositol;D-Inositol | | CAS: | 643-12-9 | | MF: | C6H12O6 | | MW: | 180.16 | | EINECS: | 211-394-0 | | Product Categories: | Food and Feed Additive;Miscellaneous Natural Products;All Inositols;Biochemistry;Sugars;Vitamin Related Compounds;PHARMACEUTICALS;Vitamins;Inositols | | Mol File: | 643-12-9.mol |  |
| | D-(+)-CHIRO-INOSITOL Chemical Properties |
| Melting point | 230 °C | | Boiling point | 232.96°C (rough estimate) | | density | 1.2805 (rough estimate) | | refractive index | 1.5730 (estimate) | | storage temp. | 2-8°C | | solubility | Water | | pka | 12.63±0.70(Predicted) | | form | Solid | | color | White to Off-White | | optical activity | [α]23/D +60°, c = 1.2 in H2O | | Water Solubility | 403.4g/L(11 ºC) | | InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1 | | InChIKey | CDAISMWEOUEBRE-LKPKBOIGSA-N | | SMILES | O[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O | | CAS DataBase Reference | 643-12-9(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | D-(+)-CHIRO-INOSITOL Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | The inositols and their phosphates have been used in the development of metabolically stable insulin mediators, inhibitors, and modulators of important metabolic functions such as glycolysis. Inositols are stable to degradative enzymes in vivo because they lack a hydrolytically labile glycosidic linkage. | | Definition | ChEBI: Myo-inositol is an inositol having myo- configuration. It has a role as a member of compatible osmolytes, a nutrient, an EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor, a human metabolite, a Daphnia magna metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite and a mouse metabolite. | | Biochem/physiol Actions | Important second messenger in insulin signal transduction. |
| | D-(+)-CHIRO-INOSITOL Preparation Products And Raw materials |
|
