|
| | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid Basic information |
| Product Name: | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid | | Synonyms: | AEEA-AEEA;8-Amino-3,6-dioxaoctanoic acid dimer≥ 98% (HPLC);H-Adoa-Adoa-OH;2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid;17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecan;7-amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadeca;H2N-PEG2-CH2CONH-PEG2-CH2COOH;17-amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecan-1-oicaci | | CAS: | 1143516-05-5 | | MF: | C12H24N2O7 | | MW: | 308.33 | | EINECS: | | | Product Categories: | 1143516-05-5;ADC LINKER | | Mol File: | 1143516-05-5.mol |  |
| | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid Chemical Properties |
| Melting point | 133 - 135°C | | Boiling point | 548.7±50.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) | | pka | 3.39±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C12H24N2O7/c13-1-3-18-5-7-20-9-11(15)14-2-4-19-6-8-21-10-12(16)17/h1-10,13H2,(H,14,15)(H,16,17) | | InChIKey | YQZVQKYXWPIKIX-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCOCCNC(=O)COCCOCCN | | CAS DataBase Reference | 1143516-05-5 |
| | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid is used for preparation of glutamic acid-containing acylating reagents for selective acylation of amino group(s) in peptides or proteins. | | Synthesis | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid is synthesized by Hydrolysis Reaction of 12,12-Dimethyl-10-oxo-3,6,11-trioxa-9-azatridecanoic acid with Hydrolysis Reaction in Dichloromethane for 2h. |
| | 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid Preparation Products And Raw materials |
|
