|
| | 2,3,6,7,10,11-Triphenylenehexol Basic information |
| Product Name: | 2,3,6,7,10,11-Triphenylenehexol | | Synonyms: | 2,3,6,7,10,11-HEXAHYDROXYTRIPHENYLENE;2,3,6,7,10,11-HEXAHYDROXYTRIPHENYLENE 95+%;2,3,6,7,10,11-Triphenylenehexol;triphenylene-2,3,6,7,10,11-hexol;JACS-4877-80-9;2,3,6,7,10,11-HexahydroxytriphenyleneHydrate>;2,3,6,7,10,11-Hexahydroxytriphenylene hydrate, 95%, for synthesis;Triphenylene-2，3，6，7，10，11-hexaol Monohydrate | | CAS: | 4877-80-9 | | MF: | C18H12O6 | | MW: | 324.28 | | EINECS: | | | Product Categories: | Building Blocks for Discotic Liquid Crystals;Building Blocks for Liquid Crystals;Functional Materials | | Mol File: | 4877-80-9.mol |  |
| | 2,3,6,7,10,11-Triphenylenehexol Chemical Properties |
| Melting point | >300℃ | | Boiling point | 776.3±55.0 °C(Predicted) | | density | 1.778 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | very slightly in Tetrahydrofuran | | form | powder to crystal | | pka | 8.46±0.30(Predicted) | | color | Light gray to Brown to Black | | InChI | InChI=1S/C18H12O6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6,19-24H | | InChIKey | QMLILIIMKSKLES-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C4C2=CC(O)=C(O)C=4)=CC(O)=C(O)C=3)=CC(O)=C1O | | CAS DataBase Reference | 4877-80-9 |
| | 2,3,6,7,10,11-Triphenylenehexol Usage And Synthesis |
| Chemical Properties | Light brown to brown powder |
| | 2,3,6,7,10,11-Triphenylenehexol Preparation Products And Raw materials |
|
