|
| | ROSAVIN Basic information |
| Product Name: | ROSAVIN | | Synonyms: | b-D-Glucopyranoside,(2E)-3-phenyl-2-propen-1-yl 6-O-a-L-arabinopyranosyl-;(2E)-3-Phenylprop-2-en-1-yl 6-O-α-L-arabinopyranosyl-β-D-glucopyranoside;(2R,3R,4S,5S,6R)-2-[(E)-3-Phenylprop-2-enoxy]-6-([(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl)oxane-3,4,5-triol;(E)-3-Phenyl-2-propenyl 6-O-a-L-arabinopyranosyl-β-D-glucopyranoside;(2R,3R,4S,5S,6R)-2-(CinnAmyloxy)-6-((((2R,3R,4S,5S)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)o;2-(3-phenylprop-2-enoxy)-6-[(3,4,5-trihydroxy-2-oxanyl)oxymethyl]oxane-3,4,5-triol;ROSAVIN;[(E)-3-Phenyl-2-propenyl]6-O-(α-L-arabinopyranosyl)-β-D-glucopyranoside | | CAS: | 84954-92-7 | | MF: | C20H28O10 | | MW: | 428.43 | | EINECS: | | | Product Categories: | standardized herbal extract;chemical reagent;Miscellaneous Natural Products;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;Natural Plant Extract | | Mol File: | 84954-92-7.mol |  |
| | ROSAVIN Chemical Properties |
| Melting point | 171～173℃ | | Boiling point | 709.1±60.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | H2O: ≥5mg/mL (warmed) | | form | powder | | pka | 12.89±0.70(Predicted) | | color | white to beige | | optical activity | [α]/D -47 to -57° (C=1, MeOH CHCl3 (1:1)) | | InChIKey | RINHYCZCUGCZAJ-PFXHMXLMNA-N | | SMILES | [C@@H]1(CO[C@@H]2OC[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]([C@@H](O)[C@H](OC/C=C/C2=CC=CC=C2)O1)O |&1:0,3,6,8,10,12,14,15,17,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29329990 |
| | ROSAVIN Usage And Synthesis |
| Uses | Rosavin is a glycoside antioxidant from Rhadiola rosea that exhibits antidepressant, anxiolytic and adaptogenic properties. | | Definition | ChEBI: Rosavin is an O-acyl carbohydrate. | | General Description | This substance is a primary reference substance with assigned absolute purity (considering chromatographic purity, water, residual solvents, inorganic impurities). The exact value can be found on the certificate. Produced by PhytoLab GmbH & Co. KG | | Biochem/physiol Actions | Rosavin is a well-known glycoside antioxidant from Rhadiola rosea (Golden Root, or Arctic Root) that exhibits antidepressant, anxiolytic and adaptogenic properties. |
| | ROSAVIN Preparation Products And Raw materials |
|
