|
| | 3-Oxocyclobutanecarboxylic acid Basic information |
| | 3-Oxocyclobutanecarboxylic acid Chemical Properties |
| Melting point | 69-70℃ | | Boiling point | 296°C | | density | 1.431 | | Fp | 147°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Solid | | pka | 4.35±0.20(Predicted) | | color | Off-white | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C5H6O3/c6-4-1-3(2-4)5(7)8/h3H,1-2H2,(H,7,8) | | InChIKey | IENOFRJPUPTEMI-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CC(=O)C1 | | CAS DataBase Reference | 23761-23-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26-37-60 | | TSCA | No | | HS Code | 29189900 |
| | 3-Oxocyclobutanecarboxylic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 3-Oxocyclobutanecarboxylic Acid (cas# 23761-23-1) is a compound useful in organic synthesis. | | Application | 3-Oxocyclobutanecarboxylic acid is a very important medicine intermediate, it is widely applied in the synthetic of tens kinds of bulk drugs, such as ACK1 antibody, the MDM2 antagonist, the JAK inhibitor, CETP inhibitor, kinase inhibitor, the PDE10 inhibitor, thrombin inhibitors and in autoimmunization chronic inflammatory diseases and antitumor drug, all being used to. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 53, p. 3841, 1988 DOI: 10.1021/jo00251a033 |
| | 3-Oxocyclobutanecarboxylic acid Preparation Products And Raw materials |
|
